C15H14F3NO2S — CID 52570534
N-methyl-2-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 52570534) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is N-methyl-2-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | N-methyl-2-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 52570534 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-methyl-2-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H14F3NO2S/c1-19(14(20)9-13-3-2-8-22-13)10-11-4-6-12(7-5-11)21-15(16,17)18/h2-8H,9-10H2,1H3 |
| InChIKey | YOMJDRITLDKHLS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |