C16H16F3NO2S2 — CID 78845854
N-methyl-N-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetamide (PubChem CID 78845854) has the molecular formula C16H16F3NO2S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-methyl-N-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetamide.
| Compound Name | N-methyl-N-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 78845854 |
| Molecular Formula | C16H16F3NO2S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-methyl-N-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetamide |
| SMILES | CN(Cc1cccs1)C(=O)CSCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO2S2/c1-20(9-14-3-2-8-24-14)15(21)11-23-10-12-4-6-13(7-5-12)22-16(17,18)19/h2-8H,9-11H2,1H3 |
| InChIKey | NGXIHXQXRWWLGW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |