C21H20F3NO — CID 72708683
(1R)-N-methyl-1-naphthalen-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 72708683) has the molecular formula C21H20F3NO and a molecular weight of 359.39 g/mol. Its IUPAC name is (1R)-N-methyl-1-naphthalen-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | (1R)-N-methyl-1-naphthalen-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 72708683 |
| Molecular Formula | C21H20F3NO |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (1R)-N-methyl-1-naphthalen-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | C[C@H](c1cccc2ccccc12)N(C)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO/c1-15(19-9-5-7-17-6-3-4-8-20(17)19)25(2)14-16-10-12-18(13-11-16)26-21(22,23)24/h3-13,15H,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | NPCGCCKRSLASPG-OAHLLOKOSA-N |
| XLogP | 5.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |