C24H27N5O — CID 134794332
9-methyl-6-(2-methylphenyl)-4-(3-phenylpropylamino)-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one (PubChem CID 134794332) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 9-methyl-6-(2-methylphenyl)-4-(3-phenylpropylamino)-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one.
| Compound Name | 9-methyl-6-(2-methylphenyl)-4-(3-phenylpropylamino)-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 134794332 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 9-methyl-6-(2-methylphenyl)-4-(3-phenylpropylamino)-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
| SMILES | Cc1ccccc1N1Cc2c(NCCCc3ccccc3)ncnc2N(C)CC1=O |
| InChI | InChI=1S/C24H27N5O/c1-18-9-6-7-13-21(18)29-15-20-23(25-14-8-12-19-10-4-3-5-11-19)26-17-27-24(20)28(2)16-22(29)30/h3-7,9-11,13,17H,8,12,14-16H2,1-2H3,(H,25,26,27) |
| InChIKey | NJJLDHIEGPYHGE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|