C21H23ClN4O3S — CID 134794683
CID 134794683 (PubChem CID 134794683) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol.
| Compound Name | CID 134794683 |
|---|---|
| PubChem CID | 134794683 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | — |
| SMILES | CCc1nc2c(c(-c3ccc(Cl)cc3)n1)CCN([S+](=O)([O-])c1c(C)noc1C)CC2 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-4-19-23-18-10-12-26(30(27,28)21-13(2)25-29-14(21)3)11-9-17(18)20(24-19)15-5-7-16(22)8-6-15/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | AWKOTMABZDJKAI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|