C24H23ClF3N3O2S — CID 134788690
CID 134788690 (PubChem CID 134788690) has the molecular formula C24H23ClF3N3O2S and a molecular weight of 509.98 g/mol.
| Compound Name | CID 134788690 |
|---|---|
| PubChem CID | 134788690 |
| Molecular Formula | C24H23ClF3N3O2S |
| Molecular Weight | 509.98 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c(-c3ccc(Cl)cc3)n1)CCN([S+](=O)([O-])c1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C24H23ClF3N3O2S/c1-15(2)23-29-21-11-13-31(34(32,33)19-5-3-4-17(14-19)24(26,27)28)12-10-20(21)22(30-23)16-6-8-18(25)9-7-16/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | KVAGYNLVJYYJBH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|