C21H23N3O3S2 — CID 134800585
CID 134800585 (PubChem CID 134800585) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol.
| Compound Name | CID 134800585 |
|---|---|
| PubChem CID | 134800585 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2nc(C(C)C)nc3c2CN([S+](=O)([O-])c2cccs2)CC3)cc1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-14(2)21-22-18-10-11-24(29(25,26)19-5-4-12-28-19)13-17(18)20(23-21)15-6-8-16(27-3)9-7-15/h4-9,12,14H,10-11,13H2,1-3H3 |
| InChIKey | SIMJPQRDZVGLRW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|