C24H21N3O3S2 — CID 134791539
CID 134791539 (PubChem CID 134791539) has the molecular formula C24H21N3O3S2 and a molecular weight of 463.58 g/mol.
| Compound Name | CID 134791539 |
|---|---|
| PubChem CID | 134791539 |
| Molecular Formula | C24H21N3O3S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)nc3c2CN([S+](=O)([O-])c2cccs2)CC3)cc1 |
| InChI | InChI=1S/C24H21N3O3S2/c1-30-19-11-9-17(10-12-19)23-20-16-27(32(28,29)22-8-5-15-31-22)14-13-21(20)25-24(26-23)18-6-3-2-4-7-18/h2-12,15H,13-14,16H2,1H3 |
| InChIKey | GIOFACPOYBDKKK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|