C18H20N2O4S2 — CID 134787498
CID 134787498 (PubChem CID 134787498) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol.
| Compound Name | CID 134787498 |
|---|---|
| PubChem CID | 134787498 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2=NOC3(CCCN([S+](=O)([O-])c4cccs4)C3)C2)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-23-15-7-5-14(6-8-15)16-12-18(24-19-16)9-3-10-20(13-18)26(21,22)17-4-2-11-25-17/h2,4-8,11H,3,9-10,12-13H2,1H3 |
| InChIKey | NJZFNVDNTVUXPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|