C16H17N3O3S2 — CID 134787889
CID 134787889 (PubChem CID 134787889) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol.
| Compound Name | CID 134787889 |
|---|---|
| PubChem CID | 134787889 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1cccs1)N1CCCC2(CC(c3ccccn3)=NO2)C1 |
| InChI | InChI=1S/C16H17N3O3S2/c20-24(21,15-6-3-10-23-15)19-9-4-7-16(12-19)11-14(18-22-16)13-5-1-2-8-17-13/h1-3,5-6,8,10H,4,7,9,11-12H2 |
| InChIKey | BZYZQLYJYWCHQT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|