C21H24N2O4S — CID 134791671
CID 134791671 (PubChem CID 134791671) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol.
| Compound Name | CID 134791671 |
|---|---|
| PubChem CID | 134791671 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | — |
| SMILES | COc1cccc([S+](=O)([O-])N2CCCC3(CC(Cc4ccccc4)=NO3)C2)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-26-19-9-5-10-20(14-19)28(24,25)23-12-6-11-21(16-23)15-18(22-27-21)13-17-7-3-2-4-8-17/h2-5,7-10,14H,6,11-13,15-16H2,1H3 |
| InChIKey | ORTHKPQTFDUYRJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|