C22H26N2O5S — CID 134806248
CID 134806248 (PubChem CID 134806248) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol.
| Compound Name | CID 134806248 |
|---|---|
| PubChem CID | 134806248 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | — |
| SMILES | COc1cccc(CN2CCOC3(CCN([S+](=O)([O-])c4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C22H26N2O5S/c1-28-19-7-5-6-18(16-19)17-23-14-15-29-22(21(23)25)10-12-24(13-11-22)30(26,27)20-8-3-2-4-9-20/h2-9,16H,10-15,17H2,1H3 |
| InChIKey | IPJKOMPZLATCGW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|