C26H32N4O4S — CID 137298739
CID 137298739 (PubChem CID 137298739) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol.
| Compound Name | CID 137298739 |
|---|---|
| PubChem CID | 137298739 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | — |
| SMILES | COc1cccc(N2C(=O)N/C(=N\C3CCCCC3)C23CCN([S+](=O)([O-])c2ccccc2)CC3)c1 |
| InChI | InChI=1S/C26H32N4O4S/c1-34-22-12-8-11-21(19-22)30-25(31)28-24(27-20-9-4-2-5-10-20)26(30)15-17-29(18-16-26)35(32,33)23-13-6-3-7-14-23/h3,6-8,11-14,19-20H,2,4-5,9-10,15-18H2,1H3,(H-,27,28,31,32,33) |
| InChIKey | RUJBCKVPRPJIQQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|