C23H35N5O — CID 137298793
4-cyclohexylimino-8-(3-methylbutyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 137298793) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is 4-cyclohexylimino-8-(3-methylbutyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-8-(3-methylbutyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298793 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 4-cyclohexylimino-8-(3-methylbutyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CC(C)CCN1CCC2(CC1)/C(=N/C1CCCCC1)NC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C23H35N5O/c1-18(2)10-14-27-15-11-23(12-16-27)21(25-19-7-4-3-5-8-19)26-22(29)28(23)20-9-6-13-24-17-20/h6,9,13,17-19H,3-5,7-8,10-12,14-16H2,1-2H3,(H,25,26,29) |
| InChIKey | QRSNBHLAIMBBDN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|