C36H39F7N6O5 — CID 171924651
8-[[6-(benzylamino)-3-pyridinyl]methyl]-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171924651) has the molecular formula C36H39F7N6O5 and a molecular weight of 768.73 g/mol. Its IUPAC name is 8-[[6-(benzylamino)-3-pyridinyl]methyl]-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-[[6-(benzylamino)-3-pyridinyl]methyl]-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171924651 |
| Molecular Formula | C36H39F7N6O5 |
| Molecular Weight | 768.73 g/mol |
| Exact Mass | 768.29 |
| IUPAC Name | 8-[[6-(benzylamino)-3-pyridinyl]methyl]-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C1N/C(=N\C2CCCCC2)C2(CCN(Cc3ccc(NCc4ccccc4)nc3)CC2)N1c1cccc(F)c1 |
| InChI | InChI=1S/C32H37FN6O.2C2HF3O2/c33-26-10-7-13-28(20-26)39-31(40)37-30(36-27-11-5-2-6-12-27)32(39)16-18-38(19-17-32)23-25-14-15-29(35-22-25)34-21-24-8-3-1-4-9-24;2*3-2(4,5)1(6)7/h1,3-4,7-10,13-15,20,22,27H,2,5-6,11-12,16-19,21,23H2,(H,34,35)(H,36,37,40);2*(H,6,7) |
| InChIKey | LGYWTSBBMPRAJL-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.73 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|