C24H34N4O2 — CID 137298758
4-cyclohexylimino-8-(cyclopropylmethyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 137298758) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-cyclohexylimino-8-(cyclopropylmethyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-8-(cyclopropylmethyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298758 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 4-cyclohexylimino-8-(cyclopropylmethyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | COc1cccc(N2C(=O)N/C(=N\C3CCCCC3)C23CCN(CC2CC2)CC3)c1 |
| InChI | InChI=1S/C24H34N4O2/c1-30-21-9-5-8-20(16-21)28-23(29)26-22(25-19-6-3-2-4-7-19)24(28)12-14-27(15-13-24)17-18-10-11-18/h5,8-9,16,18-19H,2-4,6-7,10-15,17H2,1H3,(H,25,26,29) |
| InChIKey | VZSZOLKVGCBDAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|