C26H32N4O2 — CID 137298907
9-benzyl-4-cyclopentylimino-1-(3-methoxyphenyl)-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298907) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 9-benzyl-4-cyclopentylimino-1-(3-methoxyphenyl)-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 9-benzyl-4-cyclopentylimino-1-(3-methoxyphenyl)-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298907 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 9-benzyl-4-cyclopentylimino-1-(3-methoxyphenyl)-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | COc1cccc(N2C(=O)N/C(=N\C3CCCC3)C23CCCN(Cc2ccccc2)C3)c1 |
| InChI | InChI=1S/C26H32N4O2/c1-32-23-14-7-13-22(17-23)30-25(31)28-24(27-21-11-5-6-12-21)26(30)15-8-16-29(19-26)18-20-9-3-2-4-10-20/h2-4,7,9-10,13-14,17,21H,5-6,8,11-12,15-16,18-19H2,1H3,(H,27,28,31) |
| InChIKey | GWEXTLUAUPHAIH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|