C25H27F3N4O — CID 137298924
4-cyclopentylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298924) has the molecular formula C25H27F3N4O and a molecular weight of 456.51 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298924 |
| Molecular Formula | C25H27F3N4O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCC2)C2(CCCN(Cc3ccc(F)cc3)C2)N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H27F3N4O/c26-18-8-6-17(7-9-18)15-31-11-3-10-25(16-31)23(29-21-4-1-2-5-21)30-24(33)32(25)22-13-19(27)12-20(28)14-22/h6-9,12-14,21H,1-5,10-11,15-16H2,(H,29,30,33) |
| InChIKey | QTKWIWSOQMCBAJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|