C26H30F2N4O2 — CID 137298994
4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[(4-methoxyphenyl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298994) has the molecular formula C26H30F2N4O2 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[(4-methoxyphenyl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[(4-methoxyphenyl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298994 |
| Molecular Formula | C26H30F2N4O2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[(4-methoxyphenyl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | COc1ccc(CN2CCC3(C2)/C(=N/C2CCCCC2)NC(=O)N3c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C26H30F2N4O2/c1-34-23-9-7-18(8-10-23)16-31-12-11-26(17-31)24(29-21-5-3-2-4-6-21)30-25(33)32(26)22-14-19(27)13-20(28)15-22/h7-10,13-15,21H,2-6,11-12,16-17H2,1H3,(H,29,30,33) |
| InChIKey | YXSPOTYDZZDHMQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|