C26H30FN5O2 — CID 136592841
4-cyclohexylimino-1-(3-fluorophenyl)-8-[(3-nitrosophenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 136592841) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3-fluorophenyl)-8-[(3-nitrosophenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-[(3-nitrosophenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 136592841 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-[(3-nitrosophenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=Nc1cccc(CN2CCC3(CC2)/C(=N/C2CCCCC2)NC(=O)N3c2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H30FN5O2/c27-20-7-5-11-23(17-20)32-25(33)29-24(28-21-8-2-1-3-9-21)26(32)12-14-31(15-13-26)18-19-6-4-10-22(16-19)30-34/h4-7,10-11,16-17,21H,1-3,8-9,12-15,18H2,(H,28,29,33) |
| InChIKey | KOIHIALCORSIGE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|