C33H38FN5O — CID 143398324
(7R)-4-cyclohexylimino-8-[(2,2-dimethyl-1H-quinolin-8-yl)methyl]-7-ethynyl-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 143398324) has the molecular formula C33H38FN5O and a molecular weight of 539.70 g/mol. Its IUPAC name is (7R)-4-cyclohexylimino-8-[(2,2-dimethyl-1H-quinolin-8-yl)methyl]-7-ethynyl-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | (7R)-4-cyclohexylimino-8-[(2,2-dimethyl-1H-quinolin-8-yl)methyl]-7-ethynyl-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 143398324 |
| Molecular Formula | C33H38FN5O |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | (7R)-4-cyclohexylimino-8-[(2,2-dimethyl-1H-quinolin-8-yl)methyl]-7-ethynyl-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | C#C[C@H]1CC2(CCN1Cc1cccc3c1NC(C)(C)C=C3)/C(=N/C1CCCCC1)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C33H38FN5O/c1-4-27-21-33(18-19-38(27)22-24-11-8-10-23-16-17-32(2,3)37-29(23)24)30(35-26-13-6-5-7-14-26)36-31(40)39(33)28-15-9-12-25(34)20-28/h1,8-12,15-17,20,26-27,37H,5-7,13-14,18-19,21-22H2,2-3H3,(H,35,36,40)/t27-,33?/m0/s1 |
| InChIKey | GFPZLRWTDUBVJS-GFDSEFBSSA-N |
| XLogP | 6.34 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|