C24H36FN4OS+ — CID 154553167
2-[(5R,7S)-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl-dimethylsulfanium (PubChem CID 154553167) has the molecular formula C24H36FN4OS+ and a molecular weight of 447.64 g/mol. Its IUPAC name is 2-[(5R,7S)-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl-dimethylsulfanium.
| Compound Name | 2-[(5R,7S)-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 154553167 |
| Molecular Formula | C24H36FN4OS+ |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-[(5R,7S)-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl-dimethylsulfanium |
| SMILES | C[C@H]1C[C@]2(CCN1CC[S+](C)C)/C(=N/C1CCCCC1)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C24H35FN4OS/c1-18-17-24(12-13-28(18)14-15-31(2)3)22(26-20-9-5-4-6-10-20)27-23(30)29(24)21-11-7-8-19(25)16-21/h7-8,11,16,18,20H,4-6,9-10,12-15,17H2,1-3H3/p+1/t18-,24+/m0/s1 |
| InChIKey | QXLLROFFUUQLLN-MHECFPHRSA-O |
| XLogP | 4.19 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|