C27H30F2N4O3 — CID 137298886
4-cyclohexylimino-1-(3,5-difluorophenyl)-9-(4-methoxybenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298886) has the molecular formula C27H30F2N4O3 and a molecular weight of 496.56 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-(4-methoxybenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-(4-methoxybenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298886 |
| Molecular Formula | C27H30F2N4O3 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-(4-methoxybenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | COc1ccc(C(=O)N2CCCC3(C2)/C(=N/C2CCCCC2)NC(=O)N3c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C27H30F2N4O3/c1-36-23-10-8-18(9-11-23)24(34)32-13-5-12-27(17-32)25(30-21-6-3-2-4-7-21)31-26(35)33(27)22-15-19(28)14-20(29)16-22/h8-11,14-16,21H,2-7,12-13,17H2,1H3,(H,30,31,35) |
| InChIKey | DYNODTKKJNRJKJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|