C24H28N4O — CID 136872758
[(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-phenylmethanone (PubChem CID 136872758) has the molecular formula C24H28N4O and a molecular weight of 388.51 g/mol. Its IUPAC name is [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-phenylmethanone.
| Compound Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-phenylmethanone |
|---|---|
| PubChem CID | 136872758 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@]2(C1)Nc1ccccc1N/C2=N\C1CCCC1 |
| InChI | InChI=1S/C24H28N4O/c29-22(18-9-2-1-3-10-18)28-16-8-15-24(17-28)23(25-19-11-4-5-12-19)26-20-13-6-7-14-21(20)27-24/h1-3,6-7,9-10,13-14,19,27H,4-5,8,11-12,15-17H2,(H,25,26)/t24-/m1/s1 |
| InChIKey | DOXTXWORBBVLDG-XMMPIXPASA-N |
| XLogP | 4.54 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|