C24H30N4O4 — CID 136872678
(3,5-dimethoxyphenyl)-[(2R)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone (PubChem CID 136872678) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[(2R)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone.
| Compound Name | (3,5-dimethoxyphenyl)-[(2R)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 136872678 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[(2R)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone |
| SMILES | COCC/N=C1\Nc2ccccc2N[C@@]12CCCN(C(=O)c1cc(OC)cc(OC)c1)C2 |
| InChI | InChI=1S/C24H30N4O4/c1-30-12-10-25-23-24(27-21-8-5-4-7-20(21)26-23)9-6-11-28(16-24)22(29)17-13-18(31-2)15-19(14-17)32-3/h4-5,7-8,13-15,27H,6,9-12,16H2,1-3H3,(H,25,26)/t24-/m1/s1 |
| InChIKey | JOOPPHWMWRHHIC-XMMPIXPASA-N |
| XLogP | 3.26 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|