C24H27N5O2 — CID 136675129
1H-indol-6-yl-[(3R)-2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone (PubChem CID 136675129) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1H-indol-6-yl-[(3R)-2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone.
| Compound Name | 1H-indol-6-yl-[(3R)-2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 136675129 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1H-indol-6-yl-[(3R)-2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone |
| SMILES | COCC/N=C1\Nc2ccccc2CN[C@@]12CCN(C(=O)c1ccc3cc[nH]c3c1)C2 |
| InChI | InChI=1S/C24H27N5O2/c1-31-13-11-26-23-24(27-15-19-4-2-3-5-20(19)28-23)9-12-29(16-24)22(30)18-7-6-17-8-10-25-21(17)14-18/h2-8,10,14,25,27H,9,11-13,15-16H2,1H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | CKMWAMAPPSVIBF-XMMPIXPASA-N |
| XLogP | 3.01 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|