C22H25ClN4O2 — CID 136872683
(3-chlorophenyl)-[(2S)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone (PubChem CID 136872683) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is (3-chlorophenyl)-[(2S)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone.
| Compound Name | (3-chlorophenyl)-[(2S)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 136872683 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3-chlorophenyl)-[(2S)-3-(2-methoxyethylimino)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]methanone |
| SMILES | COCC/N=C1\Nc2ccccc2N[C@]12CCCN(C(=O)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C22H25ClN4O2/c1-29-13-11-24-21-22(26-19-9-3-2-8-18(19)25-21)10-5-12-27(15-22)20(28)16-6-4-7-17(23)14-16/h2-4,6-9,14,26H,5,10-13,15H2,1H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | JABTVKBLIMCFJB-QFIPXVFZSA-N |
| XLogP | 3.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|