C24H31N5O3 — CID 136733886
(2R)-3-(2-methoxyethylimino)-N-(4-methoxy-2-methylphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide (PubChem CID 136733886) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2R)-3-(2-methoxyethylimino)-N-(4-methoxy-2-methylphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide.
| Compound Name | (2R)-3-(2-methoxyethylimino)-N-(4-methoxy-2-methylphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 136733886 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (2R)-3-(2-methoxyethylimino)-N-(4-methoxy-2-methylphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide |
| SMILES | COCC/N=C1\Nc2ccccc2N[C@@]12CCCN(C(=O)Nc1ccc(OC)cc1C)C2 |
| InChI | InChI=1S/C24H31N5O3/c1-17-15-18(32-3)9-10-19(17)27-23(30)29-13-6-11-24(16-29)22(25-12-14-31-2)26-20-7-4-5-8-21(20)28-24/h4-5,7-10,15,28H,6,11-14,16H2,1-3H3,(H,25,26)(H,27,30)/t24-/m1/s1 |
| InChIKey | NSWOGASJZXTCDK-XMMPIXPASA-N |
| XLogP | 3.95 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|