C25H32N4O3 — CID 136872794
[(2R)-3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 136872794) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is [(2R)-3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [(2R)-3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 136872794 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(2R)-3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC[C@]3(C2)Nc2ccccc2N/C3=N\C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C25H32N4O3/c1-24(2,3)28-23-25(27-20-10-7-6-9-19(20)26-23)13-8-14-29(16-25)22(30)18-12-11-17(31-4)15-21(18)32-5/h6-7,9-12,15,27H,8,13-14,16H2,1-5H3,(H,26,28)/t25-/m1/s1 |
| InChIKey | TXMDWRYVRYCLDD-RUZDIDTESA-N |
| XLogP | 4.41 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|