C24H31N5O2 — CID 136675150
(2R)-3-tert-butylimino-N-(2-methoxyphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide (PubChem CID 136675150) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (2R)-3-tert-butylimino-N-(2-methoxyphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide.
| Compound Name | (2R)-3-tert-butylimino-N-(2-methoxyphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 136675150 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (2R)-3-tert-butylimino-N-(2-methoxyphenyl)spiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC[C@]2(C1)Nc1ccccc1N/C2=N\C(C)(C)C |
| InChI | InChI=1S/C24H31N5O2/c1-23(2,3)28-21-24(27-18-11-6-5-10-17(18)25-21)14-9-15-29(16-24)22(30)26-19-12-7-8-13-20(19)31-4/h5-8,10-13,27H,9,14-16H2,1-4H3,(H,25,28)(H,26,30)/t24-/m1/s1 |
| InChIKey | MOERGEWYTDTTSG-XMMPIXPASA-N |
| XLogP | 4.80 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|