C22H24ClFN4O2 — CID 136666849
(5-chloro-2-fluorophenyl)-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone (PubChem CID 136666849) has the molecular formula C22H24ClFN4O2 and a molecular weight of 430.91 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 136666849 |
| Molecular Formula | C22H24ClFN4O2 |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]methanone |
| SMILES | COCC/N=C1\Nc2ccccc2CNC12CCN(C(=O)c1cc(Cl)ccc1F)C2 |
| InChI | InChI=1S/C22H24ClFN4O2/c1-30-11-9-25-21-22(26-13-15-4-2-3-5-19(15)27-21)8-10-28(14-22)20(29)17-12-16(23)6-7-18(17)24/h2-7,12,26H,8-11,13-14H2,1H3,(H,25,27) |
| InChIKey | SWUYSTZUBTVUPB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|