C21H27N5O2S — CID 136666876
2-benzylimino-N,N-dimethylspiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-sulfonamide (PubChem CID 136666876) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-benzylimino-N,N-dimethylspiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-sulfonamide.
| Compound Name | 2-benzylimino-N,N-dimethylspiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-sulfonamide |
|---|---|
| PubChem CID | 136666876 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-benzylimino-N,N-dimethylspiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC2(C1)NCc1ccccc1N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C21H27N5O2S/c1-25(2)29(27,28)26-13-12-21(16-26)20(22-14-17-8-4-3-5-9-17)24-19-11-7-6-10-18(19)15-23-21/h3-11,23H,12-16H2,1-2H3,(H,22,24) |
| InChIKey | QXGAEWGYMIKSLM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|