C20H26N6O2S — CID 136872896
(2R)-3-benzylimino-N,N-dimethylspiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-sulfonamide (PubChem CID 136872896) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is (2R)-3-benzylimino-N,N-dimethylspiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-sulfonamide.
| Compound Name | (2R)-3-benzylimino-N,N-dimethylspiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-sulfonamide |
|---|---|
| PubChem CID | 136872896 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2R)-3-benzylimino-N,N-dimethylspiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@]2(C1)Nc1cccnc1N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C20H26N6O2S/c1-25(2)29(27,28)26-13-7-11-20(15-26)19(22-14-16-8-4-3-5-9-16)23-18-17(24-20)10-6-12-21-18/h3-6,8-10,12,24H,7,11,13-15H2,1-2H3,(H,21,22,23)/t20-/m1/s1 |
| InChIKey | KLCYAHCQINXWHW-HXUWFJFHSA-N |
| XLogP | 2.16 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|