C23H29N5O — CID 136730643
(2S)-1-(3-benzyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,4'-piperidine]-1'-yl)-2-methylbutan-1-one (PubChem CID 136730643) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is (2S)-1-(3-benzyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,4'-piperidine]-1'-yl)-2-methylbutan-1-one.
| Compound Name | (2S)-1-(3-benzyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,4'-piperidine]-1'-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 136730643 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (2S)-1-(3-benzyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,4'-piperidine]-1'-yl)-2-methylbutan-1-one |
| SMILES | CC[C@H](C)C(=O)N1CCC2(CC1)Nc1cccnc1N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C23H29N5O/c1-3-17(2)21(29)28-14-11-23(12-15-28)22(25-16-18-8-5-4-6-9-18)26-20-19(27-23)10-7-13-24-20/h4-10,13,17,27H,3,11-12,14-16H2,1-2H3,(H,24,25,26)/t17-/m0/s1 |
| InChIKey | UREFLCFUSVYYKC-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|