C20H27N5 — CID 145079533
N-benzylspiro[5,8-dihydropteridine-6,1'-cyclohexane]-7-imine;ethane (PubChem CID 145079533) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-benzylspiro[5,8-dihydropteridine-6,1'-cyclohexane]-7-imine;ethane.
| Compound Name | N-benzylspiro[5,8-dihydropteridine-6,1'-cyclohexane]-7-imine;ethane |
|---|---|
| PubChem CID | 145079533 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-benzylspiro[5,8-dihydropteridine-6,1'-cyclohexane]-7-imine;ethane |
| SMILES | CC.c1ccc(C/N=C2\Nc3ncncc3NC23CCCCC3)cc1 |
| InChI | InChI=1S/C18H21N5.C2H6/c1-3-7-14(8-4-1)11-20-17-18(9-5-2-6-10-18)23-15-12-19-13-21-16(15)22-17;1-2/h1,3-4,7-8,12-13,23H,2,5-6,9-11H2,(H,19,20,21,22);1-2H3 |
| InChIKey | XKCKHMAYIZYETE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|