C19H24Cl2N4S — CID 145079161
N-[(3,4-dichlorophenyl)methyl]spiro[4,7-dihydro-[1,3]thiazolo[4,5-b]pyrazine-6,1'-cyclohexane]-5-imine;ethane (PubChem CID 145079161) has the molecular formula C19H24Cl2N4S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]spiro[4,7-dihydro-[1,3]thiazolo[4,5-b]pyrazine-6,1'-cyclohexane]-5-imine;ethane.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]spiro[4,7-dihydro-[1,3]thiazolo[4,5-b]pyrazine-6,1'-cyclohexane]-5-imine;ethane |
|---|---|
| PubChem CID | 145079161 |
| Molecular Formula | C19H24Cl2N4S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]spiro[4,7-dihydro-[1,3]thiazolo[4,5-b]pyrazine-6,1'-cyclohexane]-5-imine;ethane |
| SMILES | CC.Clc1ccc(C/N=C2\Nc3ncsc3NC23CCCCC3)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N4S.C2H6/c18-12-5-4-11(8-13(12)19)9-20-16-17(6-2-1-3-7-17)23-15-14(22-16)21-10-24-15;1-2/h4-5,8,10,23H,1-3,6-7,9H2,(H,20,22);1-2H3 |
| InChIKey | UEOMMJRIGBDZMI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|