C18H22Cl2N6 — CID 137104805
N-[(3,4-dichlorophenyl)methyl]-1',2-dimethylspiro[4,7-dihydropyrazolo[3,4-b]pyrazine-5,4'-piperidine]-6-imine (PubChem CID 137104805) has the molecular formula C18H22Cl2N6 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-1',2-dimethylspiro[4,7-dihydropyrazolo[3,4-b]pyrazine-5,4'-piperidine]-6-imine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-1',2-dimethylspiro[4,7-dihydropyrazolo[3,4-b]pyrazine-5,4'-piperidine]-6-imine |
|---|---|
| PubChem CID | 137104805 |
| Molecular Formula | C18H22Cl2N6 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-1',2-dimethylspiro[4,7-dihydropyrazolo[3,4-b]pyrazine-5,4'-piperidine]-6-imine |
| SMILES | CN1CCC2(CC1)Nc1cn(C)nc1N/C2=N\Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N6/c1-25-7-5-18(6-8-25)17(22-16-15(23-18)11-26(2)24-16)21-10-12-3-4-13(19)14(20)9-12/h3-4,9,11,23H,5-8,10H2,1-2H3,(H,21,22,24) |
| InChIKey | JDJYYQFNYQSSAV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|