C22H26ClF2N5O2 — CID 145079245
N-[(3-chlorophenyl)methyl]-5,5-difluoro-1'-methylspiro[4,6-dioxa-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-12,4'-piperidine]-11-imine;ethane (PubChem CID 145079245) has the molecular formula C22H26ClF2N5O2 and a molecular weight of 465.93 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-5,5-difluoro-1'-methylspiro[4,6-dioxa-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-12,4'-piperidine]-11-imine;ethane.
| Compound Name | N-[(3-chlorophenyl)methyl]-5,5-difluoro-1'-methylspiro[4,6-dioxa-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-12,4'-piperidine]-11-imine;ethane |
|---|---|
| PubChem CID | 145079245 |
| Molecular Formula | C22H26ClF2N5O2 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-5,5-difluoro-1'-methylspiro[4,6-dioxa-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-12,4'-piperidine]-11-imine;ethane |
| SMILES | CC.CN1CCC2(CC1)Nc1nc3c(cc1N/C2=N\Cc1cccc(Cl)c1)OC(F)(F)O3 |
| InChI | InChI=1S/C20H20ClF2N5O2.C2H6/c1-28-7-5-19(6-8-28)18(24-11-12-3-2-4-13(21)9-12)25-14-10-15-17(26-16(14)27-19)30-20(22,23)29-15;1-2/h2-4,9-10H,5-8,11H2,1H3,(H,24,25)(H,26,27);1-2H3 |
| InChIKey | KKXSXXMOFOXCFX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|