C22H28ClN5O2 — CID 146587322
N-[(3-chlorophenyl)methyl]-2-(2-methoxyethoxy)-4'-methylspiro[5,8-dihydropteridine-7,1'-cyclohexane]-6-imine (PubChem CID 146587322) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(2-methoxyethoxy)-4'-methylspiro[5,8-dihydropteridine-7,1'-cyclohexane]-6-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(2-methoxyethoxy)-4'-methylspiro[5,8-dihydropteridine-7,1'-cyclohexane]-6-imine |
|---|---|
| PubChem CID | 146587322 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(2-methoxyethoxy)-4'-methylspiro[5,8-dihydropteridine-7,1'-cyclohexane]-6-imine |
| SMILES | COCCOc1ncc2c(n1)NC1(CCC(C)CC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H28ClN5O2/c1-15-6-8-22(9-7-15)20(24-13-16-4-3-5-17(23)12-16)26-18-14-25-21(27-19(18)28-22)30-11-10-29-2/h3-5,12,14-15H,6-11,13H2,1-2H3,(H,24,26)(H,25,27,28) |
| InChIKey | ODMKFNVKENQARG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|