C25H34ClN5O — CID 145079274
2-[7-chloro-1'-methyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-yl]oxy-N,N-dimethylethanamine (PubChem CID 145079274) has the molecular formula C25H34ClN5O and a molecular weight of 456.03 g/mol. Its IUPAC name is 2-[7-chloro-1'-methyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[7-chloro-1'-methyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 145079274 |
| Molecular Formula | C25H34ClN5O |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-[7-chloro-1'-methyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-yl]oxy-N,N-dimethylethanamine |
| SMILES | Cc1cccc(C/N=C2\Nc3cc(OCCN(C)C)c(Cl)cc3NC23CCN(C)CC3)c1 |
| InChI | InChI=1S/C25H34ClN5O/c1-18-6-5-7-19(14-18)17-27-24-25(8-10-31(4)11-9-25)29-22-15-20(26)23(16-21(22)28-24)32-13-12-30(2)3/h5-7,14-16,29H,8-13,17H2,1-4H3,(H,27,28) |
| InChIKey | YKOMZMBREQTVAJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|