C20H21Cl2N3 — CID 137104775
N-benzyl-5,7-dichlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 137104775) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is N-benzyl-5,7-dichlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | N-benzyl-5,7-dichlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 137104775 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-benzyl-5,7-dichlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | Clc1cc(Cl)c2c(c1)N/C(=N\Cc1ccccc1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C20H21Cl2N3/c21-15-11-16(22)18-17(12-15)24-19(20(25-18)9-5-2-6-10-20)23-13-14-7-3-1-4-8-14/h1,3-4,7-8,11-12,25H,2,5-6,9-10,13H2,(H,23,24) |
| InChIKey | MGNHFHQVKHDZDA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|