C18H21N5 — CID 137105542
N-(pyrimidin-4-ylmethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 137105542) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(pyrimidin-4-ylmethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | N-(pyrimidin-4-ylmethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 137105542 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | N-(pyrimidin-4-ylmethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | c1ccc2c(c1)N/C(=N\Cc1ccncn1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C18H21N5/c1-4-9-18(10-5-1)17(20-12-14-8-11-19-13-21-14)22-15-6-2-3-7-16(15)23-18/h2-3,6-8,11,13,23H,1,4-5,9-10,12H2,(H,20,22) |
| InChIKey | OGHSWIGLMFAKAY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|