C23H30N4O3S — CID 136872947
(3S)-1'-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-2-imine (PubChem CID 136872947) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is (3S)-1'-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-2-imine.
| Compound Name | (3S)-1'-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-2-imine |
|---|---|
| PubChem CID | 136872947 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (3S)-1'-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-2-imine |
| SMILES | CCc1ccc(S(=O)(=O)N2CC[C@@]3(C2)NCc2ccccc2N/C3=N\CCOC)cc1 |
| InChI | InChI=1S/C23H30N4O3S/c1-3-18-8-10-20(11-9-18)31(28,29)27-14-12-23(17-27)22(24-13-15-30-2)26-21-7-5-4-6-19(21)16-25-23/h4-11,25H,3,12-17H2,1-2H3,(H,24,26)/t23-/m0/s1 |
| InChIKey | HCKMZIWBGSGVEK-QHCPKHFHSA-N |
| XLogP | 2.64 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|