C22H26N6O — CID 136666781
(3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)-pyrazin-2-ylmethanone (PubChem CID 136666781) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is (3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)-pyrazin-2-ylmethanone.
| Compound Name | (3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 136666781 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCCC2(C1)Nc1ccccc1N/C2=N\C1CCCC1 |
| InChI | InChI=1S/C22H26N6O/c29-20(19-14-23-11-12-24-19)28-13-5-10-22(15-28)21(25-16-6-1-2-7-16)26-17-8-3-4-9-18(17)27-22/h3-4,8-9,11-12,14,16,27H,1-2,5-7,10,13,15H2,(H,25,26) |
| InChIKey | HYSKJASAZDQNQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|