C25H32N6O — CID 136743815
[(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 136743815) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 136743815 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCCC2)N1CCC[C@]2(C1)Nc1ccccc1N/C2=N\C1CCCC1 |
| InChI | InChI=1S/C25H32N6O/c32-23(22-18-10-3-4-11-19(18)29-30-22)31-15-7-14-25(16-31)24(26-17-8-1-2-9-17)27-20-12-5-6-13-21(20)28-25/h5-6,12-13,17,28H,1-4,7-11,14-16H2,(H,26,27)(H,29,30)/t25-/m1/s1 |
| InChIKey | XBSRCRUEJMXLGC-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|