C27H31FN4O3 — CID 137298983
4-cyclohexylimino-8-(2-fluorobenzoyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 137298983) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is 4-cyclohexylimino-8-(2-fluorobenzoyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-8-(2-fluorobenzoyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298983 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 4-cyclohexylimino-8-(2-fluorobenzoyl)-1-(3-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | COc1cccc(N2C(=O)N/C(=N\C3CCCCC3)C23CCN(C(=O)c2ccccc2F)CC3)c1 |
| InChI | InChI=1S/C27H31FN4O3/c1-35-21-11-7-10-20(18-21)32-26(34)30-25(29-19-8-3-2-4-9-19)27(32)14-16-31(17-15-27)24(33)22-12-5-6-13-23(22)28/h5-7,10-13,18-19H,2-4,8-9,14-17H2,1H3,(H,29,30,34) |
| InChIKey | OEOGTMIYRZNIKV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|