C24H26FN5O2 — CID 137298934
4-cyclopentylimino-8-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 137298934) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-cyclopentylimino-8-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclopentylimino-8-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298934 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 4-cyclopentylimino-8-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C(c1ccccc1F)N1CCC2(CC1)/C(=N/C1CCCC1)NC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C24H26FN5O2/c25-20-10-4-3-9-19(20)21(31)29-14-11-24(12-15-29)22(27-17-6-1-2-7-17)28-23(32)30(24)18-8-5-13-26-16-18/h3-5,8-10,13,16-17H,1-2,6-7,11-12,14-15H2,(H,27,28,32) |
| InChIKey | GUPJQTTZAOKPLA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|