C25H28FN5O2 — CID 137298972
4-cyclohexylimino-9-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298972) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-cyclohexylimino-9-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-9-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298972 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-cyclohexylimino-9-(2-fluorobenzoyl)-1-pyridin-3-yl-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C(c1ccccc1F)N1CCCC2(C1)/C(=N/C1CCCCC1)NC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C25H28FN5O2/c26-21-12-5-4-11-20(21)22(32)30-15-7-13-25(17-30)23(28-18-8-2-1-3-9-18)29-24(33)31(25)19-10-6-14-27-16-19/h4-6,10-12,14,16,18H,1-3,7-9,13,15,17H2,(H,28,29,33) |
| InChIKey | ANDDMFUJMDTKGN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|