C17H23N5O3S — CID 137299535
CID 137299535 (PubChem CID 137299535) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol.
| Compound Name | CID 137299535 |
|---|---|
| PubChem CID | 137299535 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CCC2(C1)/C(=N/C1CCCC1)NC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C17H23N5O3S/c1-26(24,25)21-10-8-17(12-21)15(19-13-5-2-3-6-13)20-16(23)22(17)14-7-4-9-18-11-14/h4,7,9,11,13H,2-3,5-6,8,10,12H2,1H3,(H-,19,20,23,24,25) |
| InChIKey | QWYMKDMKEJIHLZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|