C22H26N4O4S2 — CID 137298845
CID 137298845 (PubChem CID 137298845) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol.
| Compound Name | CID 137298845 |
|---|---|
| PubChem CID | 137298845 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | — |
| SMILES | COc1cccc(N2C(=O)N/C(=N\C3CCCC3)C23CCN([S+](=O)([O-])c2cccs2)C3)c1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-30-18-9-4-8-17(14-18)26-21(27)24-20(23-16-6-2-3-7-16)22(26)11-12-25(15-22)32(28,29)19-10-5-13-31-19/h4-5,8-10,13-14,16H,2-3,6-7,11-12,15H2,1H3,(H-,23,24,27,28,29) |
| InChIKey | XRHNAMLUPVBNQE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|